About silylmethyl 4-iodobenzoate
silylmethyl 4-iodobenzoate (PubChem CID 157209971) has the molecular formula C8H9IO2Si
and a molecular weight of 292.15 g/mol. Its IUPAC name is silylmethyl 4-iodobenzoate.
Molecular Properties
| Compound Name | silylmethyl 4-iodobenzoate |
| PubChem CID | 157209971 |
| Molecular Formula | C8H9IO2Si |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 291.94 |
| IUPAC Name | silylmethyl 4-iodobenzoate |
| SMILES | O=C(OC[SiH3])c1ccc(I)cc1 |
| InChI | InChI=1S/C8H9IO2Si/c9-7-3-1-6(2-4-7)8(10)11-5-12/h1-4H,5H2,12H3 |
| InChIKey | LFCMNSHSJXGXAV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze silylmethyl 4-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silylmethyl 4-iodobenzoate?
The IUPAC name of silylmethyl 4-iodobenzoate (CID 157209971) is silylmethyl 4-iodobenzoate.
What is the SMILES notation for silylmethyl 4-iodobenzoate?
The canonical SMILES for silylmethyl 4-iodobenzoate is O=C(OC[SiH3])c1ccc(I)cc1.
What is the InChIKey of silylmethyl 4-iodobenzoate?
The InChIKey is LFCMNSHSJXGXAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IO2Si/c9-7-3-1-6(2-4-7)8(10)11-5-12/h1-4H,5H2,12H3.
What are the key properties of silylmethyl 4-iodobenzoate?
silylmethyl 4-iodobenzoate has a molecular weight of 292.15 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for silylmethyl 4-iodobenzoate is sourced from PubChem (CID 157209971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).