About (4-iodobenzoyl) 4-iodobenzenecarboperoxoate
(4-iodobenzoyl) 4-iodobenzenecarboperoxoate (PubChem CID 141495091) has the molecular formula C14H8I2O4
and a molecular weight of 494.02 g/mol. Its IUPAC name is (4-iodobenzoyl) 4-iodobenzenecarboperoxoate.
Molecular Properties
| Compound Name | (4-iodobenzoyl) 4-iodobenzenecarboperoxoate |
| PubChem CID | 141495091 |
| Molecular Formula | C14H8I2O4 |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.85 |
| IUPAC Name | (4-iodobenzoyl) 4-iodobenzenecarboperoxoate |
| SMILES | O=C(OOC(=O)c1ccc(I)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H8I2O4/c15-11-5-1-9(2-6-11)13(17)19-20-14(18)10-3-7-12(16)8-4-10/h1-8H |
| InChIKey | GOOYDOUPSCYDLO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (4-iodobenzoyl) 4-iodobenzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodobenzoyl) 4-iodobenzenecarboperoxoate?
The IUPAC name of (4-iodobenzoyl) 4-iodobenzenecarboperoxoate (CID 141495091) is (4-iodobenzoyl) 4-iodobenzenecarboperoxoate.
What is the SMILES notation for (4-iodobenzoyl) 4-iodobenzenecarboperoxoate?
The canonical SMILES for (4-iodobenzoyl) 4-iodobenzenecarboperoxoate is O=C(OOC(=O)c1ccc(I)cc1)c1ccc(I)cc1.
What is the InChIKey of (4-iodobenzoyl) 4-iodobenzenecarboperoxoate?
The InChIKey is GOOYDOUPSCYDLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8I2O4/c15-11-5-1-9(2-6-11)13(17)19-20-14(18)10-3-7-12(16)8-4-10/h1-8H.
What are the key properties of (4-iodobenzoyl) 4-iodobenzenecarboperoxoate?
(4-iodobenzoyl) 4-iodobenzenecarboperoxoate has a molecular weight of 494.02 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodobenzoyl) 4-iodobenzenecarboperoxoate is sourced from PubChem (CID 141495091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).