About [(1E)-buta-1,3-dienyl] 4-iodobenzoate
[(1E)-buta-1,3-dienyl] 4-iodobenzoate (PubChem CID 172553888) has the molecular formula C11H9IO2
and a molecular weight of 300.10 g/mol. Its IUPAC name is [(1E)-buta-1,3-dienyl] 4-iodobenzoate.
Molecular Properties
| Compound Name | [(1E)-buta-1,3-dienyl] 4-iodobenzoate |
| PubChem CID | 172553888 |
| Molecular Formula | C11H9IO2 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | [(1E)-buta-1,3-dienyl] 4-iodobenzoate |
| SMILES | C=C/C=C/OC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H9IO2/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h2-8H,1H2/b8-3+ |
| InChIKey | PQKZZPMODCHDAH-FPYGCLRLSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-buta-1,3-dienyl] 4-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-buta-1,3-dienyl] 4-iodobenzoate?
The IUPAC name of [(1E)-buta-1,3-dienyl] 4-iodobenzoate (CID 172553888) is [(1E)-buta-1,3-dienyl] 4-iodobenzoate.
What is the SMILES notation for [(1E)-buta-1,3-dienyl] 4-iodobenzoate?
The canonical SMILES for [(1E)-buta-1,3-dienyl] 4-iodobenzoate is C=C/C=C/OC(=O)c1ccc(I)cc1.
What is the InChIKey of [(1E)-buta-1,3-dienyl] 4-iodobenzoate?
The InChIKey is PQKZZPMODCHDAH-FPYGCLRLSA-N. The full InChI is InChI=1S/C11H9IO2/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h2-8H,1H2/b8-3+.
What are the key properties of [(1E)-buta-1,3-dienyl] 4-iodobenzoate?
[(1E)-buta-1,3-dienyl] 4-iodobenzoate has a molecular weight of 300.10 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-buta-1,3-dienyl] 4-iodobenzoate is sourced from PubChem (CID 172553888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).