(2E,4E)-5-benzoyloxypenta-2,4-dienoic acid

C12H10O4 — CID 12840355

IUPAC(2E,4E)-5-benzoyloxypenta-2,4-dienoic acid
SMILESO=C(O)/C=C/C=C/OC(=O)c1ccccc1
InChIInChI=1S/C12H10O4/c13-11(14)8-4-5-9-16-12(15)10-6-2-1-3-7-10/h1-9H,(H,13,14)/b8-4+,9-5+
InChIKeyJFSOHGYJEZHPLN-KBXRYBNXSA-N
MW218.21 g/mol
LogP2.00
Rot. Bonds4

About (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid

(2E,4E)-5-benzoyloxypenta-2,4-dienoic acid (PubChem CID 12840355) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4E)-5-benzoyloxypenta-2,4-dienoic acid
PubChem CID12840355
Molecular FormulaC12H10O4
Molecular Weight218.21 g/mol
Exact Mass218.06
IUPAC Name(2E,4E)-5-benzoyloxypenta-2,4-dienoic acid
SMILESO=C(O)/C=C/C=C/OC(=O)c1ccccc1
InChIInChI=1S/C12H10O4/c13-11(14)8-4-5-9-16-12(15)10-6-2-1-3-7-10/h1-9H,(H,13,14)/b8-4+,9-5+
InChIKeyJFSOHGYJEZHPLN-KBXRYBNXSA-N
XLogP2.00
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.21
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid?
The IUPAC name of (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid (CID 12840355) is (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid.
What is the SMILES notation for (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid?
The canonical SMILES for (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid is O=C(O)/C=C/C=C/OC(=O)c1ccccc1.
What is the InChIKey of (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid?
The InChIKey is JFSOHGYJEZHPLN-KBXRYBNXSA-N. The full InChI is InChI=1S/C12H10O4/c13-11(14)8-4-5-9-16-12(15)10-6-2-1-3-7-10/h1-9H,(H,13,14)/b8-4+,9-5+.
What are the key properties of (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid?
(2E,4E)-5-benzoyloxypenta-2,4-dienoic acid has a molecular weight of 218.21 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-benzoyloxypenta-2,4-dienoic acid is sourced from PubChem (CID 12840355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).