About (2-methyl-5-oxopenta-1,3-dienyl) benzoate
(2-methyl-5-oxopenta-1,3-dienyl) benzoate (PubChem CID 71364117) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is (2-methyl-5-oxopenta-1,3-dienyl) benzoate.
Molecular Properties
| Compound Name | (2-methyl-5-oxopenta-1,3-dienyl) benzoate |
| PubChem CID | 71364117 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (2-methyl-5-oxopenta-1,3-dienyl) benzoate |
| SMILES | CC(C=CC=O)=COC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H12O3/c1-11(6-5-9-14)10-16-13(15)12-7-3-2-4-8-12/h2-10H,1H3 |
| InChIKey | OWFXMJGJSGEZHZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-5-oxopenta-1,3-dienyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5-oxopenta-1,3-dienyl) benzoate?
The IUPAC name of (2-methyl-5-oxopenta-1,3-dienyl) benzoate (CID 71364117) is (2-methyl-5-oxopenta-1,3-dienyl) benzoate.
What is the SMILES notation for (2-methyl-5-oxopenta-1,3-dienyl) benzoate?
The canonical SMILES for (2-methyl-5-oxopenta-1,3-dienyl) benzoate is CC(C=CC=O)=COC(=O)c1ccccc1.
What is the InChIKey of (2-methyl-5-oxopenta-1,3-dienyl) benzoate?
The InChIKey is OWFXMJGJSGEZHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c1-11(6-5-9-14)10-16-13(15)12-7-3-2-4-8-12/h2-10H,1H3.
What are the key properties of (2-methyl-5-oxopenta-1,3-dienyl) benzoate?
(2-methyl-5-oxopenta-1,3-dienyl) benzoate has a molecular weight of 216.24 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5-oxopenta-1,3-dienyl) benzoate is sourced from PubChem (CID 71364117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).