About ethenyl benzoate;2-methylprop-1-ene
ethenyl benzoate;2-methylprop-1-ene (PubChem CID 174957134) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is ethenyl benzoate;2-methylprop-1-ene.
Molecular Properties
| Compound Name | ethenyl benzoate;2-methylprop-1-ene |
| PubChem CID | 174957134 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | ethenyl benzoate;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=COC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H8O2.C4H8/c1-2-11-9(10)8-6-4-3-5-7-8;1-4(2)3/h2-7H,1H2;1H2,2-3H3 |
| InChIKey | WYRITMDEXKUGPZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenyl benzoate;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl benzoate;2-methylprop-1-ene?
The IUPAC name of ethenyl benzoate;2-methylprop-1-ene (CID 174957134) is ethenyl benzoate;2-methylprop-1-ene.
What is the SMILES notation for ethenyl benzoate;2-methylprop-1-ene?
The canonical SMILES for ethenyl benzoate;2-methylprop-1-ene is C=C(C)C.C=COC(=O)c1ccccc1.
What is the InChIKey of ethenyl benzoate;2-methylprop-1-ene?
The InChIKey is WYRITMDEXKUGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C4H8/c1-2-11-9(10)8-6-4-3-5-7-8;1-4(2)3/h2-7H,1H2;1H2,2-3H3.
What are the key properties of ethenyl benzoate;2-methylprop-1-ene?
ethenyl benzoate;2-methylprop-1-ene has a molecular weight of 204.27 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl benzoate;2-methylprop-1-ene is sourced from PubChem (CID 174957134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).