About ethenyl 4-methoxybenzoate;propan-2-one
ethenyl 4-methoxybenzoate;propan-2-one (PubChem CID 70140612) has the molecular formula C13H16O4
and a molecular weight of 236.27 g/mol. Its IUPAC name is ethenyl 4-methoxybenzoate;propan-2-one.
Molecular Properties
| Compound Name | ethenyl 4-methoxybenzoate;propan-2-one |
| PubChem CID | 70140612 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | ethenyl 4-methoxybenzoate;propan-2-one |
| SMILES | C=COC(=O)c1ccc(OC)cc1.CC(C)=O |
| InChI | InChI=1S/C10H10O3.C3H6O/c1-3-13-10(11)8-4-6-9(12-2)7-5-8;1-3(2)4/h3-7H,1H2,2H3;1-2H3 |
| InChIKey | FQJMVKHLWHGJEV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 4-methoxybenzoate;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 4-methoxybenzoate;propan-2-one?
The IUPAC name of ethenyl 4-methoxybenzoate;propan-2-one (CID 70140612) is ethenyl 4-methoxybenzoate;propan-2-one.
What is the SMILES notation for ethenyl 4-methoxybenzoate;propan-2-one?
The canonical SMILES for ethenyl 4-methoxybenzoate;propan-2-one is C=COC(=O)c1ccc(OC)cc1.CC(C)=O.
What is the InChIKey of ethenyl 4-methoxybenzoate;propan-2-one?
The InChIKey is FQJMVKHLWHGJEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3.C3H6O/c1-3-13-10(11)8-4-6-9(12-2)7-5-8;1-3(2)4/h3-7H,1H2,2H3;1-2H3.
What are the key properties of ethenyl 4-methoxybenzoate;propan-2-one?
ethenyl 4-methoxybenzoate;propan-2-one has a molecular weight of 236.27 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 4-methoxybenzoate;propan-2-one is sourced from PubChem (CID 70140612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).