About 2-ethoxyethenyl 4-methoxybenzoate
2-ethoxyethenyl 4-methoxybenzoate (PubChem CID 123217452) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-ethoxyethenyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | 2-ethoxyethenyl 4-methoxybenzoate |
| PubChem CID | 123217452 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-ethoxyethenyl 4-methoxybenzoate |
| SMILES | CCOC=COC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H14O4/c1-3-15-8-9-16-12(13)10-4-6-11(14-2)7-5-10/h4-9H,3H2,1-2H3 |
| InChIKey | LQNMQICMSWTJSU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethenyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethenyl 4-methoxybenzoate?
The IUPAC name of 2-ethoxyethenyl 4-methoxybenzoate (CID 123217452) is 2-ethoxyethenyl 4-methoxybenzoate.
What is the SMILES notation for 2-ethoxyethenyl 4-methoxybenzoate?
The canonical SMILES for 2-ethoxyethenyl 4-methoxybenzoate is CCOC=COC(=O)c1ccc(OC)cc1.
What is the InChIKey of 2-ethoxyethenyl 4-methoxybenzoate?
The InChIKey is LQNMQICMSWTJSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-3-15-8-9-16-12(13)10-4-6-11(14-2)7-5-10/h4-9H,3H2,1-2H3.
What are the key properties of 2-ethoxyethenyl 4-methoxybenzoate?
2-ethoxyethenyl 4-methoxybenzoate has a molecular weight of 222.24 g/mol, XLogP of 2.36, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethenyl 4-methoxybenzoate is sourced from PubChem (CID 123217452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).