About ethylamino 4-methoxybenzoate
ethylamino 4-methoxybenzoate (PubChem CID 87829629) has the molecular formula C10H13NO3
and a molecular weight of 195.22 g/mol. Its IUPAC name is ethylamino 4-methoxybenzoate.
Molecular Properties
| Compound Name | ethylamino 4-methoxybenzoate |
| PubChem CID | 87829629 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | ethylamino 4-methoxybenzoate |
| SMILES | CCNOC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C10H13NO3/c1-3-11-14-10(12)8-4-6-9(13-2)7-5-8/h4-7,11H,3H2,1-2H3 |
| InChIKey | ILUAQMGNRJYTRU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethylamino 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylamino 4-methoxybenzoate?
The IUPAC name of ethylamino 4-methoxybenzoate (CID 87829629) is ethylamino 4-methoxybenzoate.
What is the SMILES notation for ethylamino 4-methoxybenzoate?
The canonical SMILES for ethylamino 4-methoxybenzoate is CCNOC(=O)c1ccc(OC)cc1.
What is the InChIKey of ethylamino 4-methoxybenzoate?
The InChIKey is ILUAQMGNRJYTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO3/c1-3-11-14-10(12)8-4-6-9(13-2)7-5-8/h4-7,11H,3H2,1-2H3.
What are the key properties of ethylamino 4-methoxybenzoate?
ethylamino 4-methoxybenzoate has a molecular weight of 195.22 g/mol, XLogP of 1.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylamino 4-methoxybenzoate is sourced from PubChem (CID 87829629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).