About anisole;methyl 4-methoxybenzoate
anisole;methyl 4-methoxybenzoate (PubChem CID 158093995) has the molecular formula C16H18O4
and a molecular weight of 274.32 g/mol. Its IUPAC name is anisole;methyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | anisole;methyl 4-methoxybenzoate |
| PubChem CID | 158093995 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | anisole;methyl 4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)cc1.COc1ccccc1 |
| InChI | InChI=1S/C9H10O3.C7H8O/c1-11-8-5-3-7(4-6-8)9(10)12-2;1-8-7-5-3-2-4-6-7/h3-6H,1-2H3;2-6H,1H3 |
| InChIKey | FOLIRGJJDRRWEF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze anisole;methyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;methyl 4-methoxybenzoate?
The IUPAC name of anisole;methyl 4-methoxybenzoate (CID 158093995) is anisole;methyl 4-methoxybenzoate.
What is the SMILES notation for anisole;methyl 4-methoxybenzoate?
The canonical SMILES for anisole;methyl 4-methoxybenzoate is COC(=O)c1ccc(OC)cc1.COc1ccccc1.
What is the InChIKey of anisole;methyl 4-methoxybenzoate?
The InChIKey is FOLIRGJJDRRWEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C7H8O/c1-11-8-5-3-7(4-6-8)9(10)12-2;1-8-7-5-3-2-4-6-7/h3-6H,1-2H3;2-6H,1H3.
What are the key properties of anisole;methyl 4-methoxybenzoate?
anisole;methyl 4-methoxybenzoate has a molecular weight of 274.32 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;methyl 4-methoxybenzoate is sourced from PubChem (CID 158093995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).