About ethane;methoxymethane;methyl benzoate
ethane;methoxymethane;methyl benzoate (PubChem CID 90999424) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is ethane;methoxymethane;methyl benzoate.
Molecular Properties
| Compound Name | ethane;methoxymethane;methyl benzoate |
| PubChem CID | 90999424 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethane;methoxymethane;methyl benzoate |
| SMILES | CC.COC.COC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O2.C2H6O.C2H6/c1-10-8(9)7-5-3-2-4-6-7;1-3-2;1-2/h2-6H,1H3;1-2H3;1-2H3 |
| InChIKey | KOMHTQNLCDEDBA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methoxymethane;methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methoxymethane;methyl benzoate?
The IUPAC name of ethane;methoxymethane;methyl benzoate (CID 90999424) is ethane;methoxymethane;methyl benzoate.
What is the SMILES notation for ethane;methoxymethane;methyl benzoate?
The canonical SMILES for ethane;methoxymethane;methyl benzoate is CC.COC.COC(=O)c1ccccc1.
What is the InChIKey of ethane;methoxymethane;methyl benzoate?
The InChIKey is KOMHTQNLCDEDBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C2H6O.C2H6/c1-10-8(9)7-5-3-2-4-6-7;1-3-2;1-2/h2-6H,1H3;1-2H3;1-2H3.
What are the key properties of ethane;methoxymethane;methyl benzoate?
ethane;methoxymethane;methyl benzoate has a molecular weight of 212.29 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methoxymethane;methyl benzoate is sourced from PubChem (CID 90999424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).