About ethenyl 4-but-3-enoyloxybenzoate
ethenyl 4-but-3-enoyloxybenzoate (PubChem CID 67807480) has the molecular formula C13H12O4
and a molecular weight of 232.23 g/mol. Its IUPAC name is ethenyl 4-but-3-enoyloxybenzoate.
Molecular Properties
| Compound Name | ethenyl 4-but-3-enoyloxybenzoate |
| PubChem CID | 67807480 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | ethenyl 4-but-3-enoyloxybenzoate |
| SMILES | C=CCC(=O)Oc1ccc(C(=O)OC=C)cc1 |
| InChI | InChI=1S/C13H12O4/c1-3-5-12(14)17-11-8-6-10(7-9-11)13(15)16-4-2/h3-4,6-9H,1-2,5H2 |
| InChIKey | VYHAEGAXDPITTK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 4-but-3-enoyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 4-but-3-enoyloxybenzoate?
The IUPAC name of ethenyl 4-but-3-enoyloxybenzoate (CID 67807480) is ethenyl 4-but-3-enoyloxybenzoate.
What is the SMILES notation for ethenyl 4-but-3-enoyloxybenzoate?
The canonical SMILES for ethenyl 4-but-3-enoyloxybenzoate is C=CCC(=O)Oc1ccc(C(=O)OC=C)cc1.
What is the InChIKey of ethenyl 4-but-3-enoyloxybenzoate?
The InChIKey is VYHAEGAXDPITTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O4/c1-3-5-12(14)17-11-8-6-10(7-9-11)13(15)16-4-2/h3-4,6-9H,1-2,5H2.
What are the key properties of ethenyl 4-but-3-enoyloxybenzoate?
ethenyl 4-but-3-enoyloxybenzoate has a molecular weight of 232.23 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 4-but-3-enoyloxybenzoate is sourced from PubChem (CID 67807480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).