About [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate
[6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate (PubChem CID 164792083) has the molecular formula C36H32O8
and a molecular weight of 592.64 g/mol. Its IUPAC name is [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate.
Molecular Properties
| Compound Name | [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate |
| PubChem CID | 164792083 |
| Molecular Formula | C36H32O8 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate |
| SMILES | C=CCCCC(=O)Oc1ccc(C(=O)Oc2ccc3cc(OC(=O)c4ccc(OC(=O)CCCC=C)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C36H32O8/c1-3-5-7-9-33(37)41-29-17-11-25(12-18-29)35(39)43-31-21-15-28-24-32(22-16-27(28)23-31)44-36(40)26-13-19-30(20-14-26)42-34(38)10-8-6-4-2/h3-4,11-24H,1-2,5-10H2 |
| InChIKey | LMIGWYZTOGCJJV-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate?
The IUPAC name of [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate (CID 164792083) is [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate.
What is the SMILES notation for [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate?
The canonical SMILES for [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate is C=CCCCC(=O)Oc1ccc(C(=O)Oc2ccc3cc(OC(=O)c4ccc(OC(=O)CCCC=C)cc4)ccc3c2)cc1.
What is the InChIKey of [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate?
The InChIKey is LMIGWYZTOGCJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H32O8/c1-3-5-7-9-33(37)41-29-17-11-25(12-18-29)35(39)43-31-21-15-28-24-32(22-16-27(28)23-31)44-36(40)26-13-19-30(20-14-26)42-34(38)10-8-6-4-2/h3-4,11-24H,1-2,5-10H2.
What are the key properties of [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate?
[6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate has a molecular weight of 592.64 g/mol, XLogP of 7.80, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-hex-5-enoyloxybenzoyl)oxynaphthalen-2-yl] 4-hex-5-enoyloxybenzoate is sourced from PubChem (CID 164792083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).