C27H32O6 — CID 100918987
[4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-oct-7-enoyloxybenzoate (PubChem CID 100918987) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is [4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-oct-7-enoyloxybenzoate.
| Compound Name | [4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-oct-7-enoyloxybenzoate |
|---|---|
| PubChem CID | 100918987 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | [4-[(2S)-2-methylbutoxy]carbonylphenyl] 4-oct-7-enoyloxybenzoate |
| SMILES | C=CCCCCCC(=O)Oc1ccc(C(=O)Oc2ccc(C(=O)OC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C27H32O6/c1-4-6-7-8-9-10-25(28)32-23-15-13-22(14-16-23)27(30)33-24-17-11-21(12-18-24)26(29)31-19-20(3)5-2/h4,11-18,20H,1,5-10,19H2,2-3H3/t20-/m0/s1 |
| InChIKey | DQBGGECOWSLVHM-FQEVSTJZSA-N |
| XLogP | 6.15 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|