C31H40O6 — CID 101036368
4-O-[4-[(2S)-2-methylbutoxy]carbonylphenyl] 1-O-undec-10-enyl benzene-1,4-dicarboxylate (PubChem CID 101036368) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is 4-O-[4-[(2S)-2-methylbutoxy]carbonylphenyl] 1-O-undec-10-enyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[(2S)-2-methylbutoxy]carbonylphenyl] 1-O-undec-10-enyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 101036368 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 4-O-[4-[(2S)-2-methylbutoxy]carbonylphenyl] 1-O-undec-10-enyl benzene-1,4-dicarboxylate |
| SMILES | C=CCCCCCCCCCOC(=O)c1ccc(C(=O)Oc2ccc(C(=O)OC[C@@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C31H40O6/c1-4-6-7-8-9-10-11-12-13-22-35-29(32)25-14-16-27(17-15-25)31(34)37-28-20-18-26(19-21-28)30(33)36-23-24(3)5-2/h4,14-21,24H,1,5-13,22-23H2,2-3H3/t24-/m0/s1 |
| InChIKey | XPPRKDNERSIOGP-DEOSSOPVSA-N |
| XLogP | 7.57 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|