About (4-acetamidophenyl) 4-iodobenzoate
(4-acetamidophenyl) 4-iodobenzoate (PubChem CID 51152655) has the molecular formula C15H12INO3
and a molecular weight of 381.17 g/mol. Its IUPAC name is (4-acetamidophenyl) 4-iodobenzoate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 4-iodobenzoate |
| PubChem CID | 51152655 |
| Molecular Formula | C15H12INO3 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | (4-acetamidophenyl) 4-iodobenzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C15H12INO3/c1-10(18)17-13-6-8-14(9-7-13)20-15(19)11-2-4-12(16)5-3-11/h2-9H,1H3,(H,17,18) |
| InChIKey | IOGFRKKIGPSZDQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 4-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 4-iodobenzoate?
The IUPAC name of (4-acetamidophenyl) 4-iodobenzoate (CID 51152655) is (4-acetamidophenyl) 4-iodobenzoate.
What is the SMILES notation for (4-acetamidophenyl) 4-iodobenzoate?
The canonical SMILES for (4-acetamidophenyl) 4-iodobenzoate is CC(=O)Nc1ccc(OC(=O)c2ccc(I)cc2)cc1.
What is the InChIKey of (4-acetamidophenyl) 4-iodobenzoate?
The InChIKey is IOGFRKKIGPSZDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12INO3/c1-10(18)17-13-6-8-14(9-7-13)20-15(19)11-2-4-12(16)5-3-11/h2-9H,1H3,(H,17,18).
What are the key properties of (4-acetamidophenyl) 4-iodobenzoate?
(4-acetamidophenyl) 4-iodobenzoate has a molecular weight of 381.17 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 4-iodobenzoate is sourced from PubChem (CID 51152655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).