C16H17ClN4O3 — CID 135481885
[4-(4-acetamidophenoxy)carbonylphenyl]-(diaminomethylidene)azanium chloride (PubChem CID 135481885) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is [4-(4-acetamidophenoxy)carbonylphenyl]-(diaminomethylidene)azanium chloride.
| Compound Name | [4-(4-acetamidophenoxy)carbonylphenyl]-(diaminomethylidene)azanium chloride |
|---|---|
| PubChem CID | 135481885 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [4-(4-acetamidophenoxy)carbonylphenyl]-(diaminomethylidene)azanium chloride |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccc([NH+]=C(N)N)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C16H16N4O3.ClH/c1-10(21)19-12-6-8-14(9-7-12)23-15(22)11-2-4-13(5-3-11)20-16(17)18;/h2-9H,1H3,(H,19,21)(H4,17,18,20);1H |
| InChIKey | CBYYAOPEHXAUHL-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|