C15H18N6O2+2 — CID 118724998
diaminomethylidene-[4-[4-(diaminomethylideneazaniumyl)benzoyl]oxyphenyl]azanium (PubChem CID 118724998) has the molecular formula C15H18N6O2+2 and a molecular weight of 314.35 g/mol. Its IUPAC name is diaminomethylidene-[4-[4-(diaminomethylideneazaniumyl)benzoyl]oxyphenyl]azanium.
| Compound Name | diaminomethylidene-[4-[4-(diaminomethylideneazaniumyl)benzoyl]oxyphenyl]azanium |
|---|---|
| PubChem CID | 118724998 |
| Molecular Formula | C15H18N6O2+2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | diaminomethylidene-[4-[4-(diaminomethylideneazaniumyl)benzoyl]oxyphenyl]azanium |
| SMILES | NC(N)=[NH+]c1ccc(OC(=O)c2ccc([NH+]=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C15H16N6O2/c16-14(17)20-10-3-1-9(2-4-10)13(22)23-12-7-5-11(6-8-12)21-15(18)19/h1-8H,(H4,16,17,20)(H4,18,19,21)/p+2 |
| InChIKey | JXJBQAMLLCEHTI-UHFFFAOYSA-P |
| XLogP | -3.12 |
| TPSA | 158.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|