C15H13IN2O4 — CID 2642847
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-iodobenzoate (PubChem CID 2642847) has the molecular formula C15H13IN2O4 and a molecular weight of 412.18 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-iodobenzoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-iodobenzoate |
|---|---|
| PubChem CID | 2642847 |
| Molecular Formula | C15H13IN2O4 |
| Molecular Weight | 412.18 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-iodobenzoate |
| SMILES | Cn1cccc1C(=O)NC(=O)COC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H13IN2O4/c1-18-8-2-3-12(18)14(20)17-13(19)9-22-15(21)10-4-6-11(16)7-5-10/h2-8H,9H2,1H3,(H,17,19,20) |
| InChIKey | OYHAHRLJNRNPQD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|