C16H14N6O4 — CID 2665575
[2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate (PubChem CID 2665575) has the molecular formula C16H14N6O4 and a molecular weight of 354.33 g/mol. Its IUPAC name is [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 2665575 |
| Molecular Formula | C16H14N6O4 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [2-[(1-methylpyrrole-2-carbonyl)amino]-2-oxoethyl] 4-(tetrazol-1-yl)benzoate |
| SMILES | Cn1cccc1C(=O)NC(=O)COC(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C16H14N6O4/c1-21-8-2-3-13(21)15(24)18-14(23)9-26-16(25)11-4-6-12(7-5-11)22-10-17-19-20-22/h2-8,10H,9H2,1H3,(H,18,23,24) |
| InChIKey | KFUMVCKPFAEMEC-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |