C20H19N5O3 — CID 31452805
[2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 4-(tetrazol-1-yl)benzoate (PubChem CID 31452805) has the molecular formula C20H19N5O3 and a molecular weight of 377.40 g/mol. Its IUPAC name is [2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 31452805 |
| Molecular Formula | C20H19N5O3 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 4-(tetrazol-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(-n2cnnn2)cc1)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H19N5O3/c26-18(21-13-20(10-11-20)16-4-2-1-3-5-16)12-28-19(27)15-6-8-17(9-7-15)25-14-22-23-24-25/h1-9,14H,10-13H2,(H,21,26) |
| InChIKey | QLWKBEPVMJIQCA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |