C21H23NO4S — CID 55525643
[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 4-methylsulfinylbenzoate (PubChem CID 55525643) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 4-methylsulfinylbenzoate.
| Compound Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 4-methylsulfinylbenzoate |
|---|---|
| PubChem CID | 55525643 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 4-methylsulfinylbenzoate |
| SMILES | CS(=O)c1ccc(C(=O)OCC(=O)NCC2(c3ccccc3)CCC2)cc1 |
| InChI | InChI=1S/C21H23NO4S/c1-27(25)18-10-8-16(9-11-18)20(24)26-14-19(23)22-15-21(12-5-13-21)17-6-3-2-4-7-17/h2-4,6-11H,5,12-15H2,1H3,(H,22,23) |
| InChIKey | REKFYSFIYFLFJP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |