C25H28N2O4 — CID 34804870
[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 3-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 34804870) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 3-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 3-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 34804870 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 3-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(CN2CCCC2=O)c1)NCC1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C25H28N2O4/c28-22(26-18-25(12-6-13-25)21-9-2-1-3-10-21)17-31-24(30)20-8-4-7-19(15-20)16-27-14-5-11-23(27)29/h1-4,7-10,15H,5-6,11-14,16-18H2,(H,26,28) |
| InChIKey | XZYROHBWAAPPNU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |