C20H24N4O3 — CID 55640954
[2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 55640954) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 55640954 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [2-oxo-2-[(1-phenylcyclobutyl)methylamino]ethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | CN(CC(=O)OCC(=O)NCC1(c2ccccc2)CCC1)c1ncccn1 |
| InChI | InChI=1S/C20H24N4O3/c1-24(19-21-11-6-12-22-19)13-18(26)27-14-17(25)23-15-20(9-5-10-20)16-7-3-2-4-8-16/h2-4,6-8,11-12H,5,9-10,13-15H2,1H3,(H,23,25) |
| InChIKey | ZGEAWWPKNFQUBI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |