C12H17N5O4 — CID 46602827
[2-(ethylcarbamoylamino)-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 46602827) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 46602827 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | CCNC(=O)NC(=O)COC(=O)CN(C)c1ncccn1 |
| InChI | InChI=1S/C12H17N5O4/c1-3-13-12(20)16-9(18)8-21-10(19)7-17(2)11-14-5-4-6-15-11/h4-6H,3,7-8H2,1-2H3,(H2,13,16,18,20) |
| InChIKey | NXZZJCQJJPIGNB-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |