C16H17FN4O3 — CID 46602636
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate (PubChem CID 46602636) has the molecular formula C16H17FN4O3 and a molecular weight of 332.34 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 46602636 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-[methyl(pyrimidin-2-yl)amino]acetate |
| SMILES | CN(CC(=O)OCC(=O)NCc1ccc(F)cc1)c1ncccn1 |
| InChI | InChI=1S/C16H17FN4O3/c1-21(16-18-7-2-8-19-16)10-15(23)24-11-14(22)20-9-12-3-5-13(17)6-4-12/h2-8H,9-11H2,1H3,(H,20,22) |
| InChIKey | GJFJJZZEYPPIRH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |