C19H20FNO4 — CID 7185613
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-phenoxybutanoate (PubChem CID 7185613) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-phenoxybutanoate.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 7185613 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 4-phenoxybutanoate |
| SMILES | O=C(COC(=O)CCCOc1ccccc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO4/c20-16-10-8-15(9-11-16)13-21-18(22)14-25-19(23)7-4-12-24-17-5-2-1-3-6-17/h1-3,5-6,8-11H,4,7,12-14H2,(H,21,22) |
| InChIKey | CQNAWCAIEAZOHF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|