C18H17F2NO4 — CID 2588876
[2-(2,4-difluoroanilino)-2-oxoethyl] 4-phenoxybutanoate (PubChem CID 2588876) has the molecular formula C18H17F2NO4 and a molecular weight of 349.33 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 4-phenoxybutanoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-phenoxybutanoate |
|---|---|
| PubChem CID | 2588876 |
| Molecular Formula | C18H17F2NO4 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-phenoxybutanoate |
| SMILES | O=C(COC(=O)CCCOc1ccccc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H17F2NO4/c19-13-8-9-16(15(20)11-13)21-17(22)12-25-18(23)7-4-10-24-14-5-2-1-3-6-14/h1-3,5-6,8-9,11H,4,7,10,12H2,(H,21,22) |
| InChIKey | HTQKBNMFDSMNRS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|