C16H13F2NO4 — CID 2506722
[2-(2,5-difluoroanilino)-2-oxoethyl] 2-phenoxyacetate (PubChem CID 2506722) has the molecular formula C16H13F2NO4 and a molecular weight of 321.28 g/mol. Its IUPAC name is [2-(2,5-difluoroanilino)-2-oxoethyl] 2-phenoxyacetate.
| Compound Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 2506722 |
| Molecular Formula | C16H13F2NO4 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [2-(2,5-difluoroanilino)-2-oxoethyl] 2-phenoxyacetate |
| SMILES | O=C(COC(=O)COc1ccccc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2NO4/c17-11-6-7-13(18)14(8-11)19-15(20)9-23-16(21)10-22-12-4-2-1-3-5-12/h1-8H,9-10H2,(H,19,20) |
| InChIKey | VKTVNBBPSVWGRH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |