About (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate
(2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate (PubChem CID 8915415) has the molecular formula C16H14FNO4
and a molecular weight of 303.29 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate.
Molecular Properties
| Compound Name | (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate |
| PubChem CID | 8915415 |
| Molecular Formula | C16H14FNO4 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cccc(F)c1)Nc1ccccc1 |
| InChI | InChI=1S/C16H14FNO4/c17-12-5-4-8-14(9-12)21-11-16(20)22-10-15(19)18-13-6-2-1-3-7-13/h1-9H,10-11H2,(H,18,19) |
| InChIKey | BHLXYYBEBSFKKE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate?
The IUPAC name of (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate (CID 8915415) is (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate.
What is the SMILES notation for (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate?
The canonical SMILES for (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate is O=C(COC(=O)COc1cccc(F)c1)Nc1ccccc1.
What is the InChIKey of (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate?
The InChIKey is BHLXYYBEBSFKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO4/c17-12-5-4-8-14(9-12)21-11-16(20)22-10-15(19)18-13-6-2-1-3-7-13/h1-9H,10-11H2,(H,18,19).
What are the key properties of (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate?
(2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate has a molecular weight of 303.29 g/mol, XLogP of 2.39, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-anilino-2-oxoethyl) 2-(3-fluorophenoxy)acetate is sourced from PubChem (CID 8915415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).