C17H15BrFNO4 — CID 8915777
[2-(3-bromo-4-methylanilino)-2-oxoethyl] 2-(3-fluorophenoxy)acetate (PubChem CID 8915777) has the molecular formula C17H15BrFNO4 and a molecular weight of 396.21 g/mol. Its IUPAC name is [2-(3-bromo-4-methylanilino)-2-oxoethyl] 2-(3-fluorophenoxy)acetate.
| Compound Name | [2-(3-bromo-4-methylanilino)-2-oxoethyl] 2-(3-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8915777 |
| Molecular Formula | C17H15BrFNO4 |
| Molecular Weight | 396.21 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | [2-(3-bromo-4-methylanilino)-2-oxoethyl] 2-(3-fluorophenoxy)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)COc2cccc(F)c2)cc1Br |
| InChI | InChI=1S/C17H15BrFNO4/c1-11-5-6-13(8-15(11)18)20-16(21)9-24-17(22)10-23-14-4-2-3-12(19)7-14/h2-8H,9-10H2,1H3,(H,20,21) |
| InChIKey | ANNZGBDUTFXRPN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |