C21H15F2NO4 — CID 2498559
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenoxybenzoate (PubChem CID 2498559) has the molecular formula C21H15F2NO4 and a molecular weight of 383.35 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenoxybenzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenoxybenzoate |
|---|---|
| PubChem CID | 2498559 |
| Molecular Formula | C21H15F2NO4 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-phenoxybenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Oc1ccccc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H15F2NO4/c22-14-10-11-18(17(23)12-14)24-20(25)13-27-21(26)16-8-4-5-9-19(16)28-15-6-2-1-3-7-15/h1-12H,13H2,(H,24,25) |
| InChIKey | FTUAYUKTACETAI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |