C15H11ClF2N2O3 — CID 7864568
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate (PubChem CID 7864568) has the molecular formula C15H11ClF2N2O3 and a molecular weight of 340.71 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7864568 |
| Molecular Formula | C15H11ClF2N2O3 |
| Molecular Weight | 340.71 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-amino-4-chlorobenzoate |
| SMILES | Nc1cc(Cl)ccc1C(=O)OCC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H11ClF2N2O3/c16-8-1-3-10(12(19)5-8)15(22)23-7-14(21)20-13-4-2-9(17)6-11(13)18/h1-6H,7,19H2,(H,20,21) |
| InChIKey | GSURPUPSTLDBQB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|