C22H18FNO4 — CID 2454502
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenoxybenzoate (PubChem CID 2454502) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenoxybenzoate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenoxybenzoate |
|---|---|
| PubChem CID | 2454502 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-phenoxybenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccccc2Oc2ccccc2)cc1F |
| InChI | InChI=1S/C22H18FNO4/c1-15-11-12-16(13-19(15)23)24-21(25)14-27-22(26)18-9-5-6-10-20(18)28-17-7-3-2-4-8-17/h2-13H,14H2,1H3,(H,24,25) |
| InChIKey | DTEGSGAWDZAIEZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |