C15H13FN2O4 — CID 2411097
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate (PubChem CID 2411097) has the molecular formula C15H13FN2O4 and a molecular weight of 304.28 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2411097 |
| Molecular Formula | C15H13FN2O4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 2-oxo-1H-pyridine-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc[nH]c2=O)cc1F |
| InChI | InChI=1S/C15H13FN2O4/c1-9-4-5-10(7-12(9)16)18-13(19)8-22-15(21)11-3-2-6-17-14(11)20/h2-7H,8H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | NWWBVGRMEGFEEC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |