C24H22N2O5 — CID 2498662
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxybenzoate (PubChem CID 2498662) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxybenzoate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxybenzoate |
|---|---|
| PubChem CID | 2498662 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 2-phenoxybenzoate |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)COC(=O)c2ccccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-26(2)23(28)17-12-14-18(15-13-17)25-22(27)16-30-24(29)20-10-6-7-11-21(20)31-19-8-4-3-5-9-19/h3-15H,16H2,1-2H3,(H,25,27) |
| InChIKey | YBDVSVDLQOSVBO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |