About [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate (PubChem CID 40910833) has the molecular formula C25H24N2O5
and a molecular weight of 432.48 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate.
Molecular Properties
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate |
| PubChem CID | 40910833 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)COC(=O)c2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-27(2)24(29)19-11-13-21(14-12-19)26-23(28)17-32-25(30)20-9-6-10-22(15-20)31-16-18-7-4-3-5-8-18/h3-15H,16-17H2,1-2H3,(H,26,28) |
| InChIKey | BKZWHZDGDZUSCI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate?
The IUPAC name of [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate (CID 40910833) is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate.
What is the SMILES notation for [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate?
The canonical SMILES for [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate is CN(C)C(=O)c1ccc(NC(=O)COC(=O)c2cccc(OCc3ccccc3)c2)cc1.
What is the InChIKey of [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate?
The InChIKey is BKZWHZDGDZUSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O5/c1-27(2)24(29)19-11-13-21(14-12-19)26-23(28)17-32-25(30)20-9-6-10-22(15-20)31-16-18-7-4-3-5-8-18/h3-15H,16-17H2,1-2H3,(H,26,28).
What are the key properties of [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate?
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate has a molecular weight of 432.48 g/mol, XLogP of 3.76, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-phenylmethoxybenzoate is sourced from PubChem (CID 40910833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).