C17H16N2O5 — CID 7625803
[2-(carbamoylamino)-2-oxoethyl] 3-phenylmethoxybenzoate (PubChem CID 7625803) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-phenylmethoxybenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 7625803 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-phenylmethoxybenzoate |
| SMILES | NC(=O)NC(=O)COC(=O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H16N2O5/c18-17(22)19-15(20)11-24-16(21)13-7-4-8-14(9-13)23-10-12-5-2-1-3-6-12/h1-9H,10-11H2,(H3,18,19,20,22) |
| InChIKey | PDZGONAXWQYCSC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |