C25H24O4 — CID 7240043
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-phenylmethoxybenzoate (PubChem CID 7240043) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-phenylmethoxybenzoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 7240043 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 3-phenylmethoxybenzoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2cccc(OCc3ccccc3)c2)cc1C |
| InChI | InChI=1S/C25H24O4/c1-17-12-19(3)23(13-18(17)2)24(26)16-29-25(27)21-10-7-11-22(14-21)28-15-20-8-5-4-6-9-20/h4-14H,15-16H2,1-3H3 |
| InChIKey | QWJZALMCZXQOGE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |