C23H18O6 — CID 7625798
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-phenylmethoxybenzoate (PubChem CID 7625798) has the molecular formula C23H18O6 and a molecular weight of 390.39 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-phenylmethoxybenzoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 7625798 |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-phenylmethoxybenzoate |
| SMILES | O=C(COC(=O)c1cccc(OCc2ccccc2)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18O6/c24-20(17-9-10-21-22(12-17)29-15-28-21)14-27-23(25)18-7-4-8-19(11-18)26-13-16-5-2-1-3-6-16/h1-12H,13-15H2 |
| InChIKey | FCAHNJOTJOTRAS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |