C23H19NO6 — CID 7625220
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-(phenoxymethyl)benzoate (PubChem CID 7625220) has the molecular formula C23H19NO6 and a molecular weight of 405.41 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-(phenoxymethyl)benzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-(phenoxymethyl)benzoate |
|---|---|
| PubChem CID | 7625220 |
| Molecular Formula | C23H19NO6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-(phenoxymethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(COc2ccccc2)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H19NO6/c25-22(24-18-10-11-20-21(12-18)30-15-29-20)14-28-23(26)17-8-6-16(7-9-17)13-27-19-4-2-1-3-5-19/h1-12H,13-15H2,(H,24,25) |
| InChIKey | ZVRYBEDKEQTWOG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |