C20H17N3O7 — CID 27704240
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 27704240) has the molecular formula C20H17N3O7 and a molecular weight of 411.37 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 27704240 |
| Molecular Formula | C20H17N3O7 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(CN2C(=O)CNC2=O)cc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H17N3O7/c24-17(22-14-5-6-15-16(7-14)30-11-29-15)10-28-19(26)13-3-1-12(2-4-13)9-23-18(25)8-21-20(23)27/h1-7H,8-11H2,(H,21,27)(H,22,24) |
| InChIKey | BPGKDAQMPSSNBR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|