C14H13ClN2O4 — CID 46691602
2-chloroprop-2-enyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 46691602) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | 2-chloroprop-2-enyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 46691602 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-chloroprop-2-enyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | C=C(Cl)COC(=O)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C14H13ClN2O4/c1-9(15)8-21-13(19)11-4-2-10(3-5-11)7-17-12(18)6-16-14(17)20/h2-5H,1,6-8H2,(H,16,20) |
| InChIKey | WODWRTLSIPPELU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|