C19H23N3O7 — CID 27704396
[2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 27704396) has the molecular formula C19H23N3O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 27704396 |
| Molecular Formula | C19H23N3O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [2-[(4-ethoxy-4-oxobutyl)amino]-2-oxoethyl] 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C19H23N3O7/c1-2-28-17(25)4-3-9-20-15(23)12-29-18(26)14-7-5-13(6-8-14)11-22-16(24)10-21-19(22)27/h5-8H,2-4,9-12H2,1H3,(H,20,23)(H,21,27) |
| InChIKey | GHLISVMRSPLTHM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|