C18H16N2O4 — CID 17454076
benzyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 17454076) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is benzyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | benzyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 17454076 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | benzyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C18H16N2O4/c21-16-10-19-18(23)20(16)11-13-6-8-15(9-7-13)17(22)24-12-14-4-2-1-3-5-14/h1-9H,10-12H2,(H,19,23) |
| InChIKey | NACMGRCGLPZLAP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|