C20H15ClN4O5 — CID 16611794
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 16611794) has the molecular formula C20H15ClN4O5 and a molecular weight of 426.82 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 16611794 |
| Molecular Formula | C20H15ClN4O5 |
| Molecular Weight | 426.82 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 4-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C20H15ClN4O5/c21-15-7-5-13(6-8-15)18-24-23-16(30-18)11-29-19(27)14-3-1-12(2-4-14)10-25-17(26)9-22-20(25)28/h1-8H,9-11H2,(H,22,28) |
| InChIKey | PFJDBKIMVBHRIH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.82 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|