C19H12ClN3O5 — CID 7951211
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7951211) has the molecular formula C19H12ClN3O5 and a molecular weight of 397.77 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7951211 |
| Molecular Formula | C19H12ClN3O5 |
| Molecular Weight | 397.77 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OCc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C19H12ClN3O5/c20-12-7-5-11(6-8-12)17-22-21-15(28-17)10-27-16(24)9-23-18(25)13-3-1-2-4-14(13)19(23)26/h1-8H,9-10H2 |
| InChIKey | GZJCHRRJWOCRLW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.77 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|