C20H14ClN3O5 — CID 8926274
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8926274) has the molecular formula C20H14ClN3O5 and a molecular weight of 411.80 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8926274 |
| Molecular Formula | C20H14ClN3O5 |
| Molecular Weight | 411.80 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCc1nnc(-c2ccc(Cl)cc2)o1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H14ClN3O5/c1-11(24-18(25)14-4-2-3-5-15(14)19(24)26)20(27)28-10-16-22-23-17(29-16)12-6-8-13(21)9-7-12/h2-9,11H,10H2,1H3/t11-/m0/s1 |
| InChIKey | OWUSXTDBEGQPDS-NSHDSACASA-N |
| XLogP | 3.12 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.80 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|