C21H17N3O5 — CID 46788877
[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 46788877) has the molecular formula C21H17N3O5 and a molecular weight of 391.38 g/mol. Its IUPAC name is [3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 46788877 |
| Molecular Formula | C21H17N3O5 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc(-c2noc(COC(=O)C(C)N3C(=O)c4ccccc4C3=O)n2)cc1 |
| InChI | InChI=1S/C21H17N3O5/c1-12-7-9-14(10-8-12)18-22-17(29-23-18)11-28-21(27)13(2)24-19(25)15-5-3-4-6-16(15)20(24)26/h3-10,13H,11H2,1-2H3 |
| InChIKey | XIVHWVSMLFVDJJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|