C22H17FN2O5 — CID 8749844
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 8749844) has the molecular formula C22H17FN2O5 and a molecular weight of 408.39 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 8749844 |
| Molecular Formula | C22H17FN2O5 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1c(COC(=O)[C@H](C)N2C(=O)c3ccccc3C2=O)noc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H17FN2O5/c1-12-18(24-30-19(12)14-7-9-15(23)10-8-14)11-29-22(28)13(2)25-20(26)16-5-3-4-6-17(16)21(25)27/h3-10,13H,11H2,1-2H3/t13-/m0/s1 |
| InChIKey | XZOPXGAZFHVAJR-ZDUSSCGKSA-N |
| XLogP | 3.52 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|